1. المادة: خشب الصنوبر + فرو الأرنب + الزغب + المطاط
2. الحجم: السحب: 28x21 سم، خمسة ثقوب: 33.5x26x10 سم، ثمانية ثقوب: 40x33.5x10 سم
3. الكائن المناسب: القطط
4. الميزات: فأر محاكاة، تفاعل بشري مع الحيوانات الأليفة، تصميم كرة فرو الأرنب
5. المقبض يوحي بمهارات مخفية، تصميم شق، يمكن إضافة النعناع القططي
6. تصميم علمي، يحسن الذكاء

1. المادة: خشب، معدن، بلاستيك
2. الاستخدام: الهامستر، الطيور، الأرانب، إلخ.
3. تحتوي مجموعة 9 قطع على: مخروط صنوبر ×2، خشب مربع ×2، حلقة ×1، أرجوحة ×1، فرع تفاح ×1 كيس، دمبل صغير ×1، كرة بطيخ ×1
4. تحتوي مجموعة 10 قطع على: نفق ×1، خيط طويل ×1، مخروط صنوبر ×2، خشب مربع ×2، حلقة ×1، أرجوحة ×1، فرع تفاح ×1 كيس، طبلة زهرة صغيرة ×1
5. تحتوي مجموعة 11 قطعة على: كرة بلاستيكية ×2، كرة خيط ×1، مخروط صنوبر ×2، خشب مربع ×2، طبلة زهرة صغيرة ×1، حلقة ×1، أرجوحة ×1، فرع تفاح ×1 عبوة
6. تحتوي مجموعة 12 قطعة على: نفق ×1، خيط طويل ×1، مخروط صنوبر ×2، خشب مربع ×2، طبلة زهرة صغيرة ×1، حلقة ×1، أرجوحة ×1، فرع تفاح ×1 كيس، دمبل صغير ×1، عجلة صغيرة ×1
7. تحتوي مجموعة 15 قطعة على: نفق ×1، خيط طويل ×1، مخروط صنوبر ×2، خشب مربع ×2، طبلة زهرة صغيرة ×1، حلقة ×1، أرجوحة ×1، فرع تفاح ×1 كيس، دمبل صغير ×1، عجلة صغيرة ×1، دمبل كبير ×1، محور كبير ×1، كرة بطيخ ×1
8. الوزن: 9 قطع / المجموعة حوالي 156 جرام، 10 قطع / المجموعة حوالي 340 جرام، 11 قطعة / المجموعة حوالي 148 جرام، 12 قطعة / المجموعة حوالي 365 جرام، 15 قطعة / المجموعة حوالي 446 جرام

الميزات
1. الرياضات الخارجية، مظهر جيا مينغ فلو.
2. شاشة كبيرة فائقة الوضوح بحجم 1.6 بوصة، حواف ضيقة جدًا، أفضل اختيار شاشة لنمط الشاشة الدائرية، وأعلى مستوى من المظهر والإحساس. زجاج باندا الملكي، عالي القوة، مقاوم للتآكل والخدش.
3. دفع Alipay أصلي بدون اتصال بالإنترنت.
4. بوصلة.
5. أكثر من 100 وضع رياضي.
6. مكالمات بلوتوث عالية الدقة، اتصال واحد.
7. بطارية كبيرة 340mAh، عمر بطارية قوي.
8. سوق الميناء.
9. معدل ضربات القلب الديناميكي، يمكن قياسه بدقة أثناء الجري.
11. استهلاك منخفض للطاقة مع قياس أكسجين الدم الحقيقي، قابل للتحقق (قيمة أكسجين الدم عند حبس النفس ستنخفض).
12. مقاومة ماء IP67 حقيقية، عمق ماء حقيقي 1 متر لمدة 30 دقيقة، لا مشاكل تقريبًا في الغمر بعد البيع.

المواصفات
1. المعالج: Jerry II JL7012A6
2. التخزين المدمج: 640KB
3. ذاكرة فلاش توسعة خارجية: 128Mb
4. العرض: شاشة TFT دائرية كاملة ملونة بحجم 1.6 بوصة؛ الدقة: 400*400؛
5. شاشة اللمس: غطاء زجاجي عالي الألمنيوم من باندا؛ شاشة لمس كاملة سعوية؛ تلميع كامل
6. البلوتوث: BLE الإصدار 5.1 وBT3.0 في جهاز واحد
7. مستشعر معدل ضربات القلب: يدعم معدل ضربات القلب الديناميكي، HRS3605، يقيس 36 مستوى للبشرة الداكنة؛
8. مستشعر الأكسجين في الدم: مدعوم
9. البطارية: بطارية ليثيوم بوليمر 340mAh؛ كوبالت نقي، لوحة حماية Seiko
10. عمر البطارية: وضع الاستعداد مع اتصال البلوتوث: حوالي 30 يومًا؛ الاستخدام العادي: 7~10 أيام.
11. عداد الخطى: مدعوم
12. المحرك: مدعوم
13. الميكروفون: مدعوم
14. السماعة: مدعومة
15. الأزرار: زر الطاقة وزر الوظائف
16. البوصلة: مدعومة
17. طريقة الشحن: كابل شحن مغناطيسي؛ DC5V--300mA
18. مستوى مقاومة الغبار والماء: IP67 حقيقي (عمق ماء 1 متر، 30 دقيقة)
19. مستوى الحماية الكهروستاتيكية: تلامس 4KV، هواء 8KV
20. الوظائف الرئيسية:
21. تبديل الميناء المتعدد: مدعوم، ميناء ديناميكي
22. تبديل أنماط واجهة المستخدم المتعددة: مدعوم
23. سوق الميناء: مدعوم
24. إشعارات رسائل تطبيق الهاتف المحمول: مدعوم بما في ذلك الرسائل النصية، QQ، Wechat، تويتر، فيسبوك، LinkedIn، سكايب، واتساب، لاين، فايبر، إنستغرام وغيرها من الرسائل الفورية.
25. تذكير المكالمات: مدعوم
26. مكالمات البلوتوث: مدعوم
27. الدفع دون اتصال عبر Alipay: مدعوم
28. البوصلة: مدعوم
29. بيانات الطقس: دعم الأشعة فوق البنفسجية، ضغط الهواء، سرعة الرياح، الرطوبة، الطقس
30. المساعد الصوتي: مدعوم
31. تحكم في الموسيقى عبر البلوتوث: مدعوم
32. مراقبة معدل ضربات القلب: مدعوم
33. مراقبة نسبة الأكسجين في الدم: مدعوم
34. مؤشر التوتر: مدعوم
35. دورة الحيض: مدعوم
36. عداد الخطى: مدعوم
37. مراقبة النوم: مدعوم
38. اليقظة الذهنية (إرشاد التنفس): مدعوم
39. أوضاع رياضية متعددة: دعم أكثر من 100 وضع رياضي مثل المشي، الجري، ركوب الدراجات، تسلق الجبال، كرة الريشة، كرة السلة، تنس الطاولة، القفز على الحبل، اليوغا، إلخ.
40. تذكير الجلوس: مدعوم
41. نظام تشغيل متعدد اللغات: الإنجليزية، الصينية المبسطة، الروسية، الإسبانية، الألمانية، الإيطالية، الفرنسية، البرتغالية، البولندية، الهولندية، التركية، الرومانية، العبرية، الدنماركية، السويدية، التشيكية، 20 لغة تشمل الصينية، الهنغارية، العربية، التايلاندية، والفارسية.
42. وظائف أخرى: ألعاب صغيرة، رمز الاستجابة السريعة الخاص بي، منبه، ساعة توقيت، عد تنازلي، وضع عدم الإزعاج، رفع المعصم لإضاءة الشاشة، العثور على الهاتف، تحكم عن بعد بالكاميرا، آلة حاسبة، مصباح يدوي، تقويم، إلخ.
43. التطبيق: Fundo health
44. دعم نظام الهاتف الذكي: أندرويد 7 وما فوق، iOS 9.0 وما فوق.

المظهر
1. حجم المنتج: القطر 47.5 مم × السمك 13.5 مم
2. عملية المظهر: غطاء زجاج الباندا + سبيكة التيتانيوم المطلية كهربائياً بالتفريغ & فولاذ مقاوم للصدأ 304 + غلاف سفلي بلاستيكي & عدسة أكريليك + حزام سيليكون سائل قياسي
3. الوزن: 52 جرام

1. CPU: T107, ARM CortexTM A7, quad-core, 1.0GHz
2. OS System: RTOS
3. Memory: ROM 128MB + RAM 48MB
4. Storage Extend: TF card up to 64GB (not included)
5. Card Type: SIM1 + mircro SIM, SIM2 + mircro SIM
6. Charge Port: Type-C
7. Battery: 2000mAh li-ion removable battery
8. Features: FM Radio, SOS, torch, VoLTE
9. BT: V2.1
10. Camera: Rear 0.3MP
11. Size: 146.2x65.4x17mm
12. Weight: 390g

Display Screen:
1. Size: 2.8 inch QVGA TFT screen
2. Screen resolution: 320 x 240 px

Network Bands:
EU Version:
1. 4G: FDD- LTE B1/B3/B7/B8/B20(2100/1800/2600/900/800MHz)
2. 3G: WCDMA B5/B8/B1(850/900/2100MHz)
3. 2G: GSM B5/B8/B3/B2(850/900/1800/1900MHz)
US Version:
1. 4G: FDD- LTE B2/B4/B5/B7/B12/B17/B28/B66(1900/1700/850/2600/700/700/700/1700MHz)
2. 3G: WCDMA B2/B5/B4(1900/850/1700MHz)
3. 2G: GSM B5/B8/B3/B2(850/900/1800/1900MHz)
(Note: Different versions correspond to different frequency bands)

Languages:
1. EU Version: English, Chinese, Arabic, Portuguese, Russian, Greek, French, Italian, Turkish, Spanish, German, Hebrew, Czech, Dutch, Albanian, Bulgarian, Croatian, Danish, Finnish, Macedonian , Norwegian, Polish, Serbian, Swedish, Hungarian
2. US Version: Chinese, English, Portuguese, French, Spanish, Dutch
(Note: Different versions have different corresponding languages.)

Package List:
1. Phone x 1
2. Power charger x 1
3. USB cable x 1
4. Warranty card x 1
5. Quick user Guide(In 6 languages ??(English, German, Greek, Polish, Russian, Hungarian)) x 1
6. Lock-pin x 1

1. CPU: UNISOC SC9832E, ARM Cortex-A53, quad-core, 1.4GHz
2. OS System: Android 11 (Fixed version, no upgrade available.)
3. Memory: ROM 32GB + RAM 3GB
4. Storage Extend: TF card up to 128GB (not included)
5. Card Type: SIM1-Nano SIM, SIM2-Nano SIM
6. Charge Port: Type-C; Audio Jack: 3.5 mm
7. Battery: 3000mAh li-ion removable battery
8. Features: FM Radio, SOS, torch, VoLTE
9. BT: V4.2
10. Camera: Rear 5MP; Front: 2MP
11. Size: 143.0 x 63.5 x 17.5mm
12. Weight: 173g with battery

Display Screen:
1. Size: 2.83 inch VGA IPS screen
2. Screen resolution: 480 x 640 px

Network Bands:
1. 4G: FDD- LTE B1/2/3/4/5/7/8/12/17/20/25/26/28/66
2. 3G: WCDMA B1/B2/B4/B5/B8
3. 2G: GSM B2/B3/B5/B8

Languages:
Indonesian, Malay, Catalan, Czech, Danish, German, Estonian, English, Spanish, Filipino, French, Croatian, Italian, Latvian, Lithuanian, Hungarian, Dutch, Norwegian, Polish, Portuguese, Romanian, Slovak, Finnish, Swedish, Vietnamese, Greek, Turkish, Bulgarian, Russian, Serb, Ukrainian, Armenian, Hebrew, Urdu, Arabic, Persian, Hindi, Bengali, Thai, Korean, Burmese, Japanese, Simplified Chinese, Traditional Chinese

Package List:
1. Phone x 1
2. Quick user guide x 1
3. USB cable x 1
4. Warranty card x 1

1. Lightweight and portable.
2. Made of high quality material, durable and firm.
3. Support over-temperature, over-current protection, over-voltage and short-circuit protection.
4. Qi wireless charging standard: easy to use.
5. Creative dual coil design.
6. Intelligent and safe for charging.
7. Fast charging input: 9V 1.67A; Common charging input: 5V 2A
8. Fast charging output: 9V 1.1A; Common charging output: 5V 1A
9. Working distance: within 8mm.
10. Compatible with most Qi standard mobile phones.
11. With hidden cooling holes design, effectively for heat dissipation.
12. For Huawei,Xiaomi Ulefone,Doogee,UMIDIGI,AGM phones

1. CPU: T107, ARM CortexTM A7, quad-core, 1.0GHz
2. Memory: ROM 128MB + RAM 48MB
3. Storage Extend: TF card up to 64GB (not included)
4. Card Type: SIM1 + mircro SIM, SIM2 + mircro SIM
5. Charge Port: Type-C
6. Headphone Jack: 3.5mm
7. Battery: 1500mAh li-ion removable battery
8. Features: FM Radio, OTG (reverse charging), SOS, torch, VoLTE
9. BT: V2.1
10. Camera: Rear 0.3MP
11. Size: 107.3 x 56.2 x 20.3mm

Display Screen:
1. Size: 2.8 inch inner screen, 1.77 inch outer screen
2. Screen resolution: 240 x 320 px inner screen,160 x 128px outer screen

Network Bands:
EU Version:
1. 4G: FDD- LTE B1/B3/B7/B8/B20(2100/1800/2600/900/800MHz)
2. 3G: WCDMA B5/B8/B1(850/900/2100MHz)
3. 2G: GSM B5/B8/B3/B2(850/900/1800/1900MHz)
US Version:
1. 4G: FDD- LTE B2/B4/B5/B7/B12/B17/B28/B66(1900/1700/850/2600/700/700/700/1700MHz)
2. 3G: WCDMA B2/B5/B4(1900/850/1700MHz)
3. 2G: GSM B5/B8/B3/B2(850/900/1800/1900MHz)

Languages:
1. European languages: Finnish, Swedish, Norwegian, Icelandic, Danish, Spanish, Portuguese, Italian, Greek, Slovenian, Croatian, Romanian, Bulgarian, Serbian, English, French, Irish , Dutch, German, Swiss, Polish, Czech, Hungarian, Slovak, Estonian, Latvian, Lithuanian, Russian
2. US language: Costa Rican, Cuban, Honduran, Canadian English, US English, Mexican, Dominican, Grenadian, Haitian, Nicaraguan, Salvadoran, Saint Kitts and Nevis, Saint Lucia English, Saint Vincent and the Grenadines, Trinidad and Tobago, Guatemalan, Jamaican

Package List:
1. Phone x 1
2. Power charger x 1
3. USB cable x 1
4. Warranty card x 1
5. Quick user Guide x 1

1. Material: high borosilicate glass
2. The pot body is thick and can avoid direct contact between hands and high temperature
3. Can withstand instantaneous temperature difference of -20 to 150 degrees celsius
4. V-shaped spout, high safety
5. The cup body has a scale line, so you can easily see the content capacity
6. Weight: about 350 grams
7. Size: 6x10x16.5 cm

Item Type:Hook Needle
Description:
1. Specifications: 1-1 model (1 hair per hook); 1-2 models (1-2 hairs per hook); 2-3 models (2-3 hairs per hook); 3-4 Model number (3-4 hairs per hook)
2. Placement: when not in use for a long time, it is best to touch the sewing machine oil to avoid the use of rust!
3. Note: please keep out of reach of children to avoid stab!
4. Function: this is great for beginners or to learn to ventilate lace wigs. You can customize your lace wig hair and easily repair lace wigs.
5. Features: this simple venting needle has a beautiful bronze hook end to prevent hair loss. It is easier to use than traditional German or Asian vent needles and is easy to grasp.

1. Material: ABS+stainless steel blade
2. Small and easy to store
3. Easy exchange of blades
4. The incision is even and flat
5. Widened design, easy to press
6. The lever is easily pressed, and the wire is out of the film
7. Transparent container, can clean food directly
8. Protect hands, thorns at the bottom, stabilize food
9. The bottom silicone pad is stable, wear-resistant and non-slip
10. Unit weight: 0.574kg
11. Size: 9.5x28.5cm

1. Use healthy and durable stainless steel with good anti-rust performance,
Let you drink more at ease.
2. The inside of the pot is polished by point solution, and the outside of the pot is made of bright surface, which is bright and easy to clean.
3. The personalized handle conforms to ergonomic principles, has a comfortable grip, high temperature resistance, low thermal conductivity, and effective heat insulation and anti-scalding.
4. Long-mouth spout design, convenient for water injection and more characteristic
5. The thick ring-shaped round surface and the flat bottom are heated evenly and quickly, and it is special for induction cooker, which saves energy and time.
6. Reserved air vents on the lid to prevent excessive boiling, intimate and humanized design, safe to use
7. Weight: 0.8L: 250g, 1.0L: 280g

Feature:
1. Three levels of wind volume: weak wind>natural wind>strong wind. The wind on the left and right sides is even.
2. No wing design, you dont have to worry about your hair being caught by the fan blades.
3. Equipped with 2600 mAh battery, brand new upgrade, continuous use time can reach 8-18 hours (depending on speed)
4. The neck fan has 46 ventilation holes to keep the face cool and keep makeup. A 360-degree refreshing experience, safe for children and adults to use.
5. Packing list:
1x hands-free personal fan
1x USB charging cable
1x user manual

1. Mini and compact, can be held or stood, easy to carry
2. Three-speed wind adjustment, turbine airflow, 360-degree global wind
3. Low wind noise, low noise, quiet and not annoying
4. Turbine blades, powerful silent movement
5. Large-capacity battery, long-lasting battery life
6. Battery capacity: 500mAh
7. Power supply mode: USB charging
8. Charging time: about 3h
9. Working time: 1-3h
10. Dimensions: about 12.5 x 4.2 x 5.8cm
11. Weight: about 83.4g

Material:Beech
Type:Cup
Description:
1. Unit weight: about 0.2 kg
2. Size: total length 15 cm, mouth width 8 cm, height 6 cm
3. Capacity: 101-200 ml
4. Packing: opp bag
5. Function: environmental protection
6. Style: creative

1. Lightweight and portable, comfortable to hold and easy to use
2. Visual storage bin design, fine powder
3. Ceramic grinding core, the thickness can be adjusted by rotating left and right
4. Splash-proof silicone cover, large storage capacity, dust-proof and safer
5. Material: ceramic, ABS
6. Size: about 20 x 8.2cm
7. Weight: about 277g

1. This high-performance 3D printing pen kit is designed for children to create 3D artwork and models. It supports PLA/ABS filaments and features a user-friendly design with multiple safety upgrades, making it ideal for fostering creativity and hands-on learning.
2. Adjustable Settings: LED screen displays real-time temperature (160~230 degrees Celsius). Switch between PLA/ABS modes and control speed via a sliding button.
3. Safety Upgrades: Embedded nozzle design minimizes accidental contact; includes finger guards for added protection.
4. One-Touch Operation: Simplifies filament feeding/retraction, suitable for kids.
5. Nozzle diameter: 0.7mm
6. Filament Diameter: 1.75mm
7. Power adapter: 100 - 240V
8. Complete set of accessories: Includes pen, power adapter, base, scissors, finger cover, unclogging needle, drawing board, drawing album, and 20-color PLA materials (single color 5 meters, total 100 meters).

1. The 3D Printing Pen is the newest concept in the field of three dimensional design, crafting and art.
2. When you draw an object with the 3D printing pen, it emits heated plastic, which will be instantly cooled and solidified into a sturdy structure.
3. This 3D evolutionary gadget in the art of 3D creation will help you create whatever you can image.
4. Make a wonderful gift for creative children and adults.
5. You can use this pen to draw your desired letter, shape, figure etc. by using its ABS filament.
6. Suitable for painting worker, product designer, hobbyist, children, student, etc.
7. Light-weight design can offer you more comfortable experience than the others.
8. Spinning speed is adjustable.
9. Intelligent standby function can really avoid unnecessary damage and save the electricity.

About the product
1. The 3D Printing Pen is the newest concept in the field of three dimensional design, crafting and art.
2. When you draw an object with the 3D printing pen, it emits heated plastic, which will be instantly cooled and solidified into a sturdy structure
3. This 3D evolutionary gadget in the art of 3D creation will help you create whatever you can image
4. Make a wonderful gift for creative children and adults
5. You can use this pen to draw your desired letter, shape, figure etc. by using its ABS filament
6. Suitable for painting worker, product designer, hobbyist, children, student, etc.
7. Light-weight design can offer you more comfortable experience than the others
8. Spinning speed is adjustable
9. Intelligent standby function can really avoid unnecessary damage and save the electricity

1. The 3D Printing Pen is the newest concept in the field of three dimensional design, crafting and art.
2. When you draw an object with the 3D printing pen, it emits heated plastic, which will be instantly cooled and solidified into a sturdy structure.
3. This 3D evolutionary gadget in the art of 3D creation will help you create whatever you can image.
4. Make a wonderful gift for creative children and adults.
5. You can use this pen to draw your desired letter, shape, figure etc. by using its ABS filament.
6. Suitable for painting worker, product designer, hobbyist, children, student, etc.
7. Light-weight design can offer you more comfortable experience than the others.
8. Spinning speed is adjustable.
9. Intelligent standby function can really avoid unnecessary damage and save the electricity.

1. The 3D Printing Pen is the newest concept in the field of three dimensional design, crafting and art.
2. When you draw an object with the 3D printing pen, it emits heated plastic, which will be instantly cooled and solidified into a sturdy structure.
3. This 3D evolutionary gadget in the art of 3D creation will help you create whatever you can image.
4. Make a wonderful gift for creative children and adults.
5. You can use this pen to draw your desired letter, shape, figure etc. by using its ABS filament.
6. Suitable for painting worker, product designer, hobbyist, children, student, etc.
7. Light-weight design can offer you more comfortable experience than the others.
8. Spinning speed is adjustable.
9. Intelligent standby function can really avoid unnecessary damage and save the electricity.

1. The 3D Printing Pen is the newest concept in the field of three dimensional design, crafting and art.
2. When you draw an object with the 3D printing pen, it emits heated plastic, which will be instantly cooled and solidified into a sturdy structure.
3. This 3D evolutionary gadget in the art of 3D creation will help you create whatever you can image.
4. Make a wonderful gift for creative children and adults.
5. You can use this pen to draw your desired letter, shape, figure etc. by using its ABS filament.
6. Suitable for painting worker, product designer, hobbyist, children, student, etc.
7. Light-weight design can offer you more comfortable experience than the others.
8. Spinning speed is adjustable.
9. Intelligent standby function can really avoid unnecessary damage and save the electricity.

Item type: Cleaning brush
Usage: Bathroom, kitchen
Material: Plastic
Size: 32x10cm
Package content: 1 x cleaning brush

1. Outdoor air condition.
2. Good gift for children and girl.
3. Power: USB powered.
4. There is a chargeable lithium battery inside, charging for 5 hours, the battery will be full, it can keep working for 1 hours, the machine has a USB charge line as a accessory.
5. The machine has two operating mode, freezing and natural air.
- Freezing mode: It is high technology by evaporating and freezing water. Make the sponge wet, put it in the sponge reserving zone of the behind of machine. State up the power, it can make the cool air.
- Natural air mode: Take out of the sponge, turn the power on will achieving the natural air.
6. This machine is not waterproof, so when you wet the sponge, please take it out, it is prevent from wet the machine to burn it out.

1. Name: folding Mirror
2. Size: 70mm mirror body, 58mm mirror surface, 10mm mirror thickness
3. Weight: about 85g
4. Compact and portable
5. It can be opened with one button for easy use
6. Good gifts for ladies

1. Material: PP
2. Anti-slip hand protection, faster washing and less effort in decontamination
3. Washing underwear separately is more hygienic and thorough.
4. There is a card slot design at the bottom for more secure placement.
5. Suitable for all kinds of small clothes to meet your various cleaning requirements
6. The separate handle can hold washing powder
7. Compact shape, freely placed anywhere
8. Suspended design, easy to carry and does not take up space
9. Can be soaked, rubbed and lifted easily, smooth and will not damage clothes
10. Dimensions: 32x18x7.5 cm

1. طبلة إلكترونية محمولة مع 9 وسادات طبول سيليكون، تشمل توم (3) / سنير / طبلة باس، هاي-هات / كراش (2) / رايد سيمبالز، يمكنها إنتاج صوت ممتاز ومحاكاة تأثيرات الضرب الحقيقية.
2. 12 أغنية تجريبية، 7 أصوات طبول و9 إيقاعات مرافقة، خيارات متنوعة تجعل تدريبك على الطبول أسهل.
3. مكبرات صوت ستيريو مدمجة تتيح لك الاستمتاع بالصوت بحرية؛ مع منفذ إخراج صوت 3.5 مم لتوصيل سماعات الأذن أو مكبرات صوت خارجية، ومنفذ إدخال صوت 3.5 مم لتوصيل MP3/الهاتف الذكي/الكمبيوتر اللوحي وتشغيل موسيقى المرافقة.
4. مزود ببطارية ليثيوم 1000 مللي أمبير، يدعم وظائف التسجيل والتشغيل؛ تحكم في مستوى الصوت بـ 9 مستويات وضبط سرعة تشغيل الأغاني التجريبية/المرافقة بـ 15 مستوى، عملية مرنة.
5. اللون: متعدد الألوان
6. المادة: سيليكون + بلاستيك
7. أغاني تجريبية: 12
8. الطبول: 7
9. المرافقة: 9
10. مصدر الطاقة: بطارية ليثيوم 1000 مللي أمبير أو محول طاقة DC 5V 1000 مللي أمبير
11. مواصفات المنتج: 48 × 32 × 5 سم / 18.9 × 12.6 × 2 بوصة
12. الوزن: 920 جرام / 2 رطل
13. قائمة المحتويات:
1 × طبلة إلكترونية
2 × عصي طبول
2 × دواسة استدامة
1 × سلك طاقة USB
1 × محول طاقة
1 × كابل صوت 3.5 مم
1 × دليل المستخدم (بالصينية والإنجليزية)